About 1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid
1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid (PubChem CID 158474582) has the molecular formula C26H23BClF3O2
and a molecular weight of 470.73 g/mol. Its IUPAC name is 1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid.
Molecular Properties
| Compound Name | 1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid |
| PubChem CID | 158474582 |
| Molecular Formula | C26H23BClF3O2 |
| Molecular Weight | 470.73 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid |
| SMILES | Cc1ccc(-c2ccccc2)cc1.FC(F)(F)c1ccc(Cl)cc1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C13H12.C7H4ClF3.C6H7BO2/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;8-6-3-1-5(2-4-6)7(9,10)11;8-7(9)6-4-2-1-3-5-6/h2-10H,1H3;1-4H;1-5,8-9H |
| InChIKey | HGTVKLQPHWSGMX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.73 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid?
The IUPAC name of 1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid (CID 158474582) is 1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid.
What is the SMILES notation for 1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid?
The canonical SMILES for 1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid is Cc1ccc(-c2ccccc2)cc1.FC(F)(F)c1ccc(Cl)cc1.OB(O)c1ccccc1.
What is the InChIKey of 1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid?
The InChIKey is HGTVKLQPHWSGMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C7H4ClF3.C6H7BO2/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;8-6-3-1-5(2-4-6)7(9,10)11;8-7(9)6-4-2-1-3-5-6/h2-10H,1H3;1-4H;1-5,8-9H.
What are the key properties of 1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid?
1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid has a molecular weight of 470.73 g/mol, XLogP of 6.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-(trifluoromethyl)benzene;1-methyl-4-phenylbenzene;phenylboronic acid is sourced from PubChem (CID 158474582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).