About acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one
acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one (PubChem CID 158475996) has the molecular formula C10H19N3O2
and a molecular weight of 213.28 g/mol. Its IUPAC name is acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one |
| PubChem CID | 158475996 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one |
| SMILES | CC(N)=O.Cc1cc(=O)n(C(C)(C)C)[nH]1 |
| InChI | InChI=1S/C8H14N2O.C2H5NO/c1-6-5-7(11)10(9-6)8(2,3)4;1-2(3)4/h5,9H,1-4H3;1H3,(H2,3,4) |
| InChIKey | HGYAYRXXBVHBLR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one?
The IUPAC name of acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one (CID 158475996) is acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one.
What is the SMILES notation for acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one?
The canonical SMILES for acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one is CC(N)=O.Cc1cc(=O)n(C(C)(C)C)[nH]1.
What is the InChIKey of acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one?
The InChIKey is HGYAYRXXBVHBLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O.C2H5NO/c1-6-5-7(11)10(9-6)8(2,3)4;1-2(3)4/h5,9H,1-4H3;1H3,(H2,3,4).
What are the key properties of acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one?
acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one has a molecular weight of 213.28 g/mol, XLogP of 0.73, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;2-tert-butyl-5-methyl-1H-pyrazol-3-one is sourced from PubChem (CID 158475996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).