C33H45N3O6 — CID 158476745
(1R,18R,22R,26S,29S,30S)-26-tert-butyl-7-methoxy-30-methyl-24,27-dioxo-2,23-dioxa-4,11,28-triazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3,5(10),6,8,11-pentaene-29-carbaldehyde (PubChem CID 158476745) has the molecular formula C33H45N3O6 and a molecular weight of 579.74 g/mol. Its IUPAC name is (1R,18R,22R,26S,29S,30S)-26-tert-butyl-7-methoxy-30-methyl-24,27-dioxo-2,23-dioxa-4,11,28-triazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3,5(10),6,8,11-pentaene-29-carbaldehyde.
| Compound Name | (1R,18R,22R,26S,29S,30S)-26-tert-butyl-7-methoxy-30-methyl-24,27-dioxo-2,23-dioxa-4,11,28-triazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3,5(10),6,8,11-pentaene-29-carbaldehyde |
|---|---|
| PubChem CID | 158476745 |
| Molecular Formula | C33H45N3O6 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | (1R,18R,22R,26S,29S,30S)-26-tert-butyl-7-methoxy-30-methyl-24,27-dioxo-2,23-dioxa-4,11,28-triazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3,5(10),6,8,11-pentaene-29-carbaldehyde |
| SMILES | COc1ccc2nc3c(nc2c1)O[C@H]1CN(C(=O)[C@H](C(C)(C)C)CC(=O)O[C@@H]2CCC[C@H]2CCCCC3)[C@H](C=O)[C@@H]1C |
| InChI | InChI=1S/C33H45N3O6/c1-20-27(19-37)36-18-29(20)42-31-25(34-24-15-14-22(40-5)16-26(24)35-31)12-8-6-7-10-21-11-9-13-28(21)41-30(38)17-23(32(36)39)33(2,3)4/h14-16,19-21,23,27-29H,6-13,17-18H2,1-5H3/t20-,21+,23+,27+,28+,29-/m0/s1 |
| InChIKey | PGTCEWBILWQHAV-LEOLSLCDSA-N |
| XLogP | 5.31 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|