C25H30N6O3S — CID 158477058
1-[1-(isocyanomethyl)cyclohexyl]-3-(4-piperidin-1-ylsulfonylanilino)-5H-pyrazolo[4,3-c]pyridin-4-one (PubChem CID 158477058) has the molecular formula C25H30N6O3S and a molecular weight of 494.62 g/mol. Its IUPAC name is 1-[1-(isocyanomethyl)cyclohexyl]-3-(4-piperidin-1-ylsulfonylanilino)-5H-pyrazolo[4,3-c]pyridin-4-one.
| Compound Name | 1-[1-(isocyanomethyl)cyclohexyl]-3-(4-piperidin-1-ylsulfonylanilino)-5H-pyrazolo[4,3-c]pyridin-4-one |
|---|---|
| PubChem CID | 158477058 |
| Molecular Formula | C25H30N6O3S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 1-[1-(isocyanomethyl)cyclohexyl]-3-(4-piperidin-1-ylsulfonylanilino)-5H-pyrazolo[4,3-c]pyridin-4-one |
| SMILES | [C-]#[N+]CC1(n2nc(Nc3ccc(S(=O)(=O)N4CCCCC4)cc3)c3c(=O)[nH]ccc32)CCCCC1 |
| InChI | InChI=1S/C25H30N6O3S/c1-26-18-25(13-4-2-5-14-25)31-21-12-15-27-24(32)22(21)23(29-31)28-19-8-10-20(11-9-19)35(33,34)30-16-6-3-7-17-30/h8-12,15H,2-7,13-14,16-18H2,(H,27,32)(H,28,29) |
| InChIKey | HHBPDBZFWHZBHC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|