C18H25N3O3 — CID 158477558
2-methoxyethyl 4-[(2,4-dimethylcyclopentyl)amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (PubChem CID 158477558) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-methoxyethyl 4-[(2,4-dimethylcyclopentyl)amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate.
| Compound Name | 2-methoxyethyl 4-[(2,4-dimethylcyclopentyl)amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 158477558 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-methoxyethyl 4-[(2,4-dimethylcyclopentyl)amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
| SMILES | COCCOC(=O)c1cnc2[nH]ccc2c1NC1CC(C)CC1C |
| InChI | InChI=1S/C18H25N3O3/c1-11-8-12(2)15(9-11)21-16-13-4-5-19-17(13)20-10-14(16)18(22)24-7-6-23-3/h4-5,10-12,15H,6-9H2,1-3H3,(H2,19,20,21) |
| InChIKey | DTUIDQKQXBSOCN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|