About N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen
N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen (PubChem CID 158477957) has the molecular formula C4H9N3O2S2
and a molecular weight of 195.27 g/mol. Its IUPAC name is N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen.
Molecular Properties
| Compound Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen |
| PubChem CID | 158477957 |
| Molecular Formula | C4H9N3O2S2 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen |
| SMILES | Cc1nnc(NS(C)(=O)=O)s1.[H][H] |
| InChI | InChI=1S/C4H7N3O2S2.H2/c1-3-5-6-4(10-3)7-11(2,8)9;/h1-2H3,(H,6,7);1H |
| InChIKey | HHDZOGYWFOJKBA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen?
The IUPAC name of N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen (CID 158477957) is N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen.
What is the SMILES notation for N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen?
The canonical SMILES for N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen is Cc1nnc(NS(C)(=O)=O)s1.[H][H].
What is the InChIKey of N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen?
The InChIKey is HHDZOGYWFOJKBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O2S2.H2/c1-3-5-6-4(10-3)7-11(2,8)9;/h1-2H3,(H,6,7);1H.
What are the key properties of N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen?
N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen has a molecular weight of 195.27 g/mol, XLogP of 0.46, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-1,3,4-thiadiazol-2-yl)methanesulfonamide;molecular hydrogen is sourced from PubChem (CID 158477957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).