C18H32O3Ti — CID 158478145
methanolate;titanium(4+);1,2,3-triethyl-4,5,6,7-tetrahydro-1H-inden-4-ide (PubChem CID 158478145) has the molecular formula C18H32O3Ti and a molecular weight of 344.32 g/mol. Its IUPAC name is methanolate;titanium(4+);1,2,3-triethyl-4,5,6,7-tetrahydro-1H-inden-4-ide.
| Compound Name | methanolate;titanium(4+);1,2,3-triethyl-4,5,6,7-tetrahydro-1H-inden-4-ide |
|---|---|
| PubChem CID | 158478145 |
| Molecular Formula | C18H32O3Ti |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | methanolate;titanium(4+);1,2,3-triethyl-4,5,6,7-tetrahydro-1H-inden-4-ide |
| SMILES | CCC1=C(CC)C(CC)C2=C1[CH-]CCC2.C[O-].C[O-].C[O-].[Ti+4] |
| InChI | InChI=1S/C15H23.3CH3O.Ti/c1-4-11-12(5-2)14-9-7-8-10-15(14)13(11)6-3;3*1-2;/h9,13H,4-8,10H2,1-3H3;3*1H3;/q4*-1;+4 |
| InChIKey | VMQHGOYPZUMAHH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|