About 1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron
1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron (PubChem CID 158478466) has the molecular formula C14H24FeO2
and a molecular weight of 280.19 g/mol. Its IUPAC name is 1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron.
Molecular Properties
| Compound Name | 1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron |
| PubChem CID | 158478466 |
| Molecular Formula | C14H24FeO2 |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron |
| SMILES | C1CCCC1.CC(=O)C1CCCC1C(C)=O.[Fe] |
| InChI | InChI=1S/C9H14O2.C5H10.Fe/c1-6(10)8-4-3-5-9(8)7(2)11;1-2-4-5-3-1;/h8-9H,3-5H2,1-2H3;1-5H2; |
| InChIKey | RQQUDBOLLSYJJS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron?
The IUPAC name of 1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron (CID 158478466) is 1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron.
What is the SMILES notation for 1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron?
The canonical SMILES for 1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron is C1CCCC1.CC(=O)C1CCCC1C(C)=O.[Fe].
What is the InChIKey of 1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron?
The InChIKey is RQQUDBOLLSYJJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2.C5H10.Fe/c1-6(10)8-4-3-5-9(8)7(2)11;1-2-4-5-3-1;/h8-9H,3-5H2,1-2H3;1-5H2;.
What are the key properties of 1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron?
1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron has a molecular weight of 280.19 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-acetylcyclopentyl)ethanone;cyclopentane;iron is sourced from PubChem (CID 158478466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).