C47H48N6O6 — CID 158478935
8-(azepan-1-ylmethyl)-7-hydroxy-3-(1-methylbenzimidazol-2-yl)chromen-2-one;7-hydroxy-3-(1-methylbenzimidazol-2-yl)-8-(piperidin-1-ylmethyl)chromen-2-one (PubChem CID 158478935) has the molecular formula C47H48N6O6 and a molecular weight of 792.94 g/mol. Its IUPAC name is 8-(azepan-1-ylmethyl)-7-hydroxy-3-(1-methylbenzimidazol-2-yl)chromen-2-one;7-hydroxy-3-(1-methylbenzimidazol-2-yl)-8-(piperidin-1-ylmethyl)chromen-2-one.
| Compound Name | 8-(azepan-1-ylmethyl)-7-hydroxy-3-(1-methylbenzimidazol-2-yl)chromen-2-one;7-hydroxy-3-(1-methylbenzimidazol-2-yl)-8-(piperidin-1-ylmethyl)chromen-2-one |
|---|---|
| PubChem CID | 158478935 |
| Molecular Formula | C47H48N6O6 |
| Molecular Weight | 792.94 g/mol |
| Exact Mass | 792.36 |
| IUPAC Name | 8-(azepan-1-ylmethyl)-7-hydroxy-3-(1-methylbenzimidazol-2-yl)chromen-2-one;7-hydroxy-3-(1-methylbenzimidazol-2-yl)-8-(piperidin-1-ylmethyl)chromen-2-one |
| SMILES | Cn1c(-c2cc3ccc(O)c(CN4CCCCC4)c3oc2=O)nc2ccccc21.Cn1c(-c2cc3ccc(O)c(CN4CCCCCC4)c3oc2=O)nc2ccccc21 |
| InChI | InChI=1S/C24H25N3O3.C23H23N3O3/c1-26-20-9-5-4-8-19(20)25-23(26)17-14-16-10-11-21(28)18(22(16)30-24(17)29)15-27-12-6-2-3-7-13-27;1-25-19-8-4-3-7-18(19)24-22(25)16-13-15-9-10-20(27)17(21(15)29-23(16)28)14-26-11-5-2-6-12-26/h4-5,8-11,14,28H,2-3,6-7,12-13,15H2,1H3;3-4,7-10,13,27H,2,5-6,11-12,14H2,1H3 |
| InChIKey | HHGXJXPFBRNHCE-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 143.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.94 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|