C29H31N5O6S — CID 158480394
(3S)-3-[4-(2,6-dimethoxyphenyl)-5-[[(1R,2S)-1-methoxy-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonylmethyl]-1,2,4-triazol-3-yl]-2,3-dihydroinden-1-one (PubChem CID 158480394) has the molecular formula C29H31N5O6S and a molecular weight of 577.66 g/mol. Its IUPAC name is (3S)-3-[4-(2,6-dimethoxyphenyl)-5-[[(1R,2S)-1-methoxy-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonylmethyl]-1,2,4-triazol-3-yl]-2,3-dihydroinden-1-one.
| Compound Name | (3S)-3-[4-(2,6-dimethoxyphenyl)-5-[[(1R,2S)-1-methoxy-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonylmethyl]-1,2,4-triazol-3-yl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 158480394 |
| Molecular Formula | C29H31N5O6S |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | (3S)-3-[4-(2,6-dimethoxyphenyl)-5-[[(1R,2S)-1-methoxy-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonylmethyl]-1,2,4-triazol-3-yl]-2,3-dihydroinden-1-one |
| SMILES | COc1cccc(OC)c1-n1c(CS(=O)(=O)[C@@H](C)[C@H](OC)c2ncc(C)cn2)nnc1[C@H]1CC(=O)c2ccccc21 |
| InChI | InChI=1S/C29H31N5O6S/c1-17-14-30-28(31-15-17)27(40-5)18(2)41(36,37)16-25-32-33-29(21-13-22(35)20-10-7-6-9-19(20)21)34(25)26-23(38-3)11-8-12-24(26)39-4/h6-12,14-15,18,21,27H,13,16H2,1-5H3/t18-,21-,27-/m0/s1 |
| InChIKey | SVJSHOAFCRVRLJ-DHGLHQTCSA-N |
| XLogP | 3.79 |
| TPSA | 135.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |