C19H13ClF2N2O4 — CID 158481127
6-(2,6-difluorophenyl)pyridine-3-carboxylic acid;methyl 6-chloropyridine-3-carboxylate (PubChem CID 158481127) has the molecular formula C19H13ClF2N2O4 and a molecular weight of 406.77 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)pyridine-3-carboxylic acid;methyl 6-chloropyridine-3-carboxylate.
| Compound Name | 6-(2,6-difluorophenyl)pyridine-3-carboxylic acid;methyl 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 158481127 |
| Molecular Formula | C19H13ClF2N2O4 |
| Molecular Weight | 406.77 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 6-(2,6-difluorophenyl)pyridine-3-carboxylic acid;methyl 6-chloropyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(Cl)nc1.O=C(O)c1ccc(-c2c(F)cccc2F)nc1 |
| InChI | InChI=1S/C12H7F2NO2.C7H6ClNO2/c13-8-2-1-3-9(14)11(8)10-5-4-7(6-15-10)12(16)17;1-11-7(10)5-2-3-6(8)9-4-5/h1-6H,(H,16,17);2-4H,1H3 |
| InChIKey | HHNNJARTZVPWLF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|