C18H20O8 — CID 158481229
3,4-dihydro-2,5-benzodioxocine-1,6-dione;bis(2-methylprop-2-enoic acid) (PubChem CID 158481229) has the molecular formula C18H20O8 and a molecular weight of 364.35 g/mol. Its IUPAC name is 3,4-dihydro-2,5-benzodioxocine-1,6-dione;bis(2-methylprop-2-enoic acid).
| Compound Name | 3,4-dihydro-2,5-benzodioxocine-1,6-dione;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 158481229 |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3,4-dihydro-2,5-benzodioxocine-1,6-dione;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.O=C1OCCOC(=O)c2ccccc21 |
| InChI | InChI=1S/C10H8O4.2C4H6O2/c11-9-7-3-1-2-4-8(7)10(12)14-6-5-13-9;2*1-3(2)4(5)6/h1-4H,5-6H2;2*1H2,2H3,(H,5,6) |
| InChIKey | HHNSYWRQWNHKNU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|