C20H24F12O4 — CID 158482046
bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol);methanol;naphthalene (PubChem CID 158482046) has the molecular formula C20H24F12O4 and a molecular weight of 556.38 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol);methanol;naphthalene.
| Compound Name | bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol);methanol;naphthalene |
|---|---|
| PubChem CID | 158482046 |
| Molecular Formula | C20H24F12O4 |
| Molecular Weight | 556.38 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol);methanol;naphthalene |
| SMILES | CC(O)(C(F)(F)F)C(F)(F)F.CC(O)(C(F)(F)F)C(F)(F)F.CO.CO.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.2C4H4F6O.2CH4O/c1-2-6-10-8-4-3-7-9(10)5-1;2*1-2(11,3(5,6)7)4(8,9)10;2*1-2/h1-8H;2*11H,1H3;2*2H,1H3 |
| InChIKey | HHQCSUFMIBWVGZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.38 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |