About benzene-1,2-diolate;1,10-phenanthroline;platinum(2+)
benzene-1,2-diolate;1,10-phenanthroline;platinum(2+) (PubChem CID 158482214) has the molecular formula C18H12N2O2Pt
and a molecular weight of 483.38 g/mol. Its IUPAC name is benzene-1,2-diolate;1,10-phenanthroline;platinum(2+).
Molecular Properties
| Compound Name | benzene-1,2-diolate;1,10-phenanthroline;platinum(2+) |
| PubChem CID | 158482214 |
| Molecular Formula | C18H12N2O2Pt |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | benzene-1,2-diolate;1,10-phenanthroline;platinum(2+) |
| SMILES | [O-]c1ccccc1[O-].[Pt+2].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C6H6O2.Pt/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;7-5-3-1-2-4-6(5)8;/h1-8H;1-4,7-8H;/q;;+2/p-2 |
| InChIKey | HHQROXDZEVAAIR-UHFFFAOYSA-L |
| XLogP | 2.61 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diolate;1,10-phenanthroline;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diolate;1,10-phenanthroline;platinum(2+)?
The IUPAC name of benzene-1,2-diolate;1,10-phenanthroline;platinum(2+) (CID 158482214) is benzene-1,2-diolate;1,10-phenanthroline;platinum(2+).
What is the SMILES notation for benzene-1,2-diolate;1,10-phenanthroline;platinum(2+)?
The canonical SMILES for benzene-1,2-diolate;1,10-phenanthroline;platinum(2+) is [O-]c1ccccc1[O-].[Pt+2].c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of benzene-1,2-diolate;1,10-phenanthroline;platinum(2+)?
The InChIKey is HHQROXDZEVAAIR-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H8N2.C6H6O2.Pt/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;7-5-3-1-2-4-6(5)8;/h1-8H;1-4,7-8H;/q;;+2/p-2.
What are the key properties of benzene-1,2-diolate;1,10-phenanthroline;platinum(2+)?
benzene-1,2-diolate;1,10-phenanthroline;platinum(2+) has a molecular weight of 483.38 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diolate;1,10-phenanthroline;platinum(2+) is sourced from PubChem (CID 158482214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).