C32H26Cl2FN3O3 — CID 158484740
[(R)-[(2S,3S,4R,5R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dimethyloxolan-2-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate (PubChem CID 158484740) has the molecular formula C32H26Cl2FN3O3 and a molecular weight of 590.48 g/mol. Its IUPAC name is [(R)-[(2S,3S,4R,5R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dimethyloxolan-2-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate.
| Compound Name | [(R)-[(2S,3S,4R,5R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dimethyloxolan-2-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 158484740 |
| Molecular Formula | C32H26Cl2FN3O3 |
| Molecular Weight | 590.48 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | [(R)-[(2S,3S,4R,5R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dimethyloxolan-2-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate |
| SMILES | C[C@@H]1[C@H](C)[C@@H]([C@H](OC(=O)c2ccc(-c3ccccc3)cc2)c2ccc(Cl)cc2)O[C@H]1n1cc(F)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C32H26Cl2FN3O3/c1-18-19(2)31(38-16-25(35)26-29(34)36-17-37-30(26)38)40-27(18)28(22-12-14-24(33)15-13-22)41-32(39)23-10-8-21(9-11-23)20-6-4-3-5-7-20/h3-19,27-28,31H,1-2H3/t18-,19+,27-,28+,31+/m0/s1 |
| InChIKey | ISYUPHVVDUWUDJ-BVFDVRSOSA-N |
| XLogP | 8.31 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.48 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |