About ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine
ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine (PubChem CID 158485502) has the molecular formula C20H24N8O6
and a molecular weight of 472.46 g/mol. Its IUPAC name is ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine.
Molecular Properties
| Compound Name | ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine |
| PubChem CID | 158485502 |
| Molecular Formula | C20H24N8O6 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine |
| SMILES | CCOC(=O)C(C=O)C=O.CCOC(=O)c1cnn(-c2ccnnc2)c1.NNc1ccnnc1 |
| InChI | InChI=1S/C10H10N4O2.C6H8O4.C4H6N4/c1-2-16-10(15)8-5-13-14(7-8)9-3-4-11-12-6-9;1-2-10-6(9)5(3-7)4-8;5-8-4-1-2-6-7-3-4/h3-7H,2H2,1H3;3-5H,2H2,1H3;1-3H,5H2,(H,6,8) |
| InChIKey | HIAXNDHGOOQDNA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 194.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine?
The IUPAC name of ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine (CID 158485502) is ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine.
What is the SMILES notation for ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine?
The canonical SMILES for ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine is CCOC(=O)C(C=O)C=O.CCOC(=O)c1cnn(-c2ccnnc2)c1.NNc1ccnnc1.
What is the InChIKey of ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine?
The InChIKey is HIAXNDHGOOQDNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2.C6H8O4.C4H6N4/c1-2-16-10(15)8-5-13-14(7-8)9-3-4-11-12-6-9;1-2-10-6(9)5(3-7)4-8;5-8-4-1-2-6-7-3-4/h3-7H,2H2,1H3;3-5H,2H2,1H3;1-3H,5H2,(H,6,8).
What are the key properties of ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine?
ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine has a molecular weight of 472.46 g/mol, XLogP of 0.16, 8 rotatable bonds, 2 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridazin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine is sourced from PubChem (CID 158485502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).