C31H35N3O8 — CID 158485811
[8-[(dimethylamino)methyl]-19-ethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 7-hydroxy-4-oxooctanoate (PubChem CID 158485811) has the molecular formula C31H35N3O8 and a molecular weight of 577.63 g/mol. Its IUPAC name is [8-[(dimethylamino)methyl]-19-ethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 7-hydroxy-4-oxooctanoate.
| Compound Name | [8-[(dimethylamino)methyl]-19-ethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 7-hydroxy-4-oxooctanoate |
|---|---|
| PubChem CID | 158485811 |
| Molecular Formula | C31H35N3O8 |
| Molecular Weight | 577.63 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | [8-[(dimethylamino)methyl]-19-ethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 7-hydroxy-4-oxooctanoate |
| SMILES | CCC1(OC(=O)CCC(=O)CCC(C)O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3c(CN(C)C)c(O)ccc3nc2-1 |
| InChI | InChI=1S/C31H35N3O8/c1-5-31(42-27(38)11-8-19(36)7-6-17(2)35)23-13-25-28-18(14-34(25)29(39)22(23)16-41-30(31)40)12-20-21(15-33(3)4)26(37)10-9-24(20)32-28/h9-10,12-13,17,35,37H,5-8,11,14-16H2,1-4H3 |
| InChIKey | HIBUSMAMDQHISB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 148.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|