C42H56N12O3 — CID 158488550
6-amino-9-[[3-(azetidin-1-ylmethyl)phenyl]methyl]-2-butoxy-7H-purin-8-one;2-butoxy-8-methyl-9-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]purin-6-amine (PubChem CID 158488550) has the molecular formula C42H56N12O3 and a molecular weight of 776.99 g/mol. Its IUPAC name is 6-amino-9-[[3-(azetidin-1-ylmethyl)phenyl]methyl]-2-butoxy-7H-purin-8-one;2-butoxy-8-methyl-9-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]purin-6-amine.
| Compound Name | 6-amino-9-[[3-(azetidin-1-ylmethyl)phenyl]methyl]-2-butoxy-7H-purin-8-one;2-butoxy-8-methyl-9-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 158488550 |
| Molecular Formula | C42H56N12O3 |
| Molecular Weight | 776.99 g/mol |
| Exact Mass | 776.46 |
| IUPAC Name | 6-amino-9-[[3-(azetidin-1-ylmethyl)phenyl]methyl]-2-butoxy-7H-purin-8-one;2-butoxy-8-methyl-9-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]purin-6-amine |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3cccc(CN4CCC4)c3)c2n1.CCCCOc1nc(N)c2nc(C)n(Cc3cccc(CN4CCCC4)c3)c2n1 |
| InChI | InChI=1S/C22H30N6O.C20H26N6O2/c1-3-4-12-29-22-25-20(23)19-21(26-22)28(16(2)24-19)15-18-9-7-8-17(13-18)14-27-10-5-6-11-27;1-2-3-10-28-19-23-17(21)16-18(24-19)26(20(27)22-16)13-15-7-4-6-14(11-15)12-25-8-5-9-25/h7-9,13H,3-6,10-12,14-15H2,1-2H3,(H2,23,25,26);4,6-7,11H,2-3,5,8-10,12-13H2,1H3,(H,22,27)(H2,21,23,24) |
| InChIKey | HIKHMXOQFJGWEC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 184.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.99 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|