C17H24FN3O3Si — CID 158489389
2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(4-fluorophenyl)-1,2,4-triazine-3,5-dione (PubChem CID 158489389) has the molecular formula C17H24FN3O3Si and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(4-fluorophenyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(4-fluorophenyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 158489389 |
| Molecular Formula | C17H24FN3O3Si |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(4-fluorophenyl)-1,2,4-triazine-3,5-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1ncc(=O)n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C17H24FN3O3Si/c1-17(2,3)25(4,5)24-11-10-20-16(23)21(15(22)12-19-20)14-8-6-13(18)7-9-14/h6-9,12H,10-11H2,1-5H3 |
| InChIKey | HIMUWCWRVPGGQG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|