About 4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one
4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one (PubChem CID 158491150) has the molecular formula C23H18F2N2O
and a molecular weight of 376.41 g/mol. Its IUPAC name is 4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one.
Molecular Properties
| Compound Name | 4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one |
| PubChem CID | 158491150 |
| Molecular Formula | C23H18F2N2O |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one |
| SMILES | Cn1cc(-c2cc(N)ccc2Cc2ccc(F)cc2F)c2ccccc2c1=O |
| InChI | InChI=1S/C23H18F2N2O/c1-27-13-21(18-4-2-3-5-19(18)23(27)28)20-12-17(26)9-7-14(20)10-15-6-8-16(24)11-22(15)25/h2-9,11-13H,10,26H2,1H3 |
| InChIKey | YLXGNYWWVIIFGH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one?
The IUPAC name of 4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one (CID 158491150) is 4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one.
What is the SMILES notation for 4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one?
The canonical SMILES for 4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one is Cn1cc(-c2cc(N)ccc2Cc2ccc(F)cc2F)c2ccccc2c1=O.
What is the InChIKey of 4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one?
The InChIKey is YLXGNYWWVIIFGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18F2N2O/c1-27-13-21(18-4-2-3-5-19(18)23(27)28)20-12-17(26)9-7-14(20)10-15-6-8-16(24)11-22(15)25/h2-9,11-13H,10,26H2,1H3.
What are the key properties of 4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one?
4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one has a molecular weight of 376.41 g/mol, XLogP of 4.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-amino-2-[(2,4-difluorophenyl)methyl]phenyl]-2-methylisoquinolin-1-one is sourced from PubChem (CID 158491150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).