About 4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine
4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine (PubChem CID 158491747) has the molecular formula C26H36F4N8O6
and a molecular weight of 632.62 g/mol. Its IUPAC name is 4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine.
Molecular Properties
| Compound Name | 4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine |
| PubChem CID | 158491747 |
| Molecular Formula | C26H36F4N8O6 |
| Molecular Weight | 632.62 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | 4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine |
| SMILES | O=[N+]([O-])c1cnn(C2CC(N3CCOCC3)CCC2(F)F)c1.O=[N+]([O-])c1cnn(C2CC(N3CCOCC3)CCC2(F)F)c1 |
| InChI | InChI=1S/2C13H18F2N4O3/c2*14-13(15)2-1-10(17-3-5-22-6-4-17)7-12(13)18-9-11(8-16-18)19(20)21/h2*8-10,12H,1-7H2 |
| InChIKey | HITYUCCFGRVKEM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 146.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 632.62 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine?
The IUPAC name of 4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine (CID 158491747) is 4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine.
What is the SMILES notation for 4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine?
The canonical SMILES for 4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine is O=[N+]([O-])c1cnn(C2CC(N3CCOCC3)CCC2(F)F)c1.O=[N+]([O-])c1cnn(C2CC(N3CCOCC3)CCC2(F)F)c1.
What is the InChIKey of 4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine?
The InChIKey is HITYUCCFGRVKEM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H18F2N4O3/c2*14-13(15)2-1-10(17-3-5-22-6-4-17)7-12(13)18-9-11(8-16-18)19(20)21/h2*8-10,12H,1-7H2.
What are the key properties of 4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine?
4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine has a molecular weight of 632.62 g/mol, XLogP of 3.70, 6 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4,4-difluoro-3-(4-nitropyrazol-1-yl)cyclohexyl]morpholine is sourced from PubChem (CID 158491747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).