About 2,5-dimethyl-3-propan-2-ylpyridine;ethane
2,5-dimethyl-3-propan-2-ylpyridine;ethane (PubChem CID 158491819) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 2,5-dimethyl-3-propan-2-ylpyridine;ethane.
Molecular Properties
| Compound Name | 2,5-dimethyl-3-propan-2-ylpyridine;ethane |
| PubChem CID | 158491819 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 2,5-dimethyl-3-propan-2-ylpyridine;ethane |
| SMILES | CC.Cc1cnc(C)c(C(C)C)c1 |
| InChI | InChI=1S/C10H15N.C2H6/c1-7(2)10-5-8(3)6-11-9(10)4;1-2/h5-7H,1-4H3;1-2H3 |
| InChIKey | HIUFPLMUBXKWLT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-dimethyl-3-propan-2-ylpyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-3-propan-2-ylpyridine;ethane?
The IUPAC name of 2,5-dimethyl-3-propan-2-ylpyridine;ethane (CID 158491819) is 2,5-dimethyl-3-propan-2-ylpyridine;ethane.
What is the SMILES notation for 2,5-dimethyl-3-propan-2-ylpyridine;ethane?
The canonical SMILES for 2,5-dimethyl-3-propan-2-ylpyridine;ethane is CC.Cc1cnc(C)c(C(C)C)c1.
What is the InChIKey of 2,5-dimethyl-3-propan-2-ylpyridine;ethane?
The InChIKey is HIUFPLMUBXKWLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C2H6/c1-7(2)10-5-8(3)6-11-9(10)4;1-2/h5-7H,1-4H3;1-2H3.
What are the key properties of 2,5-dimethyl-3-propan-2-ylpyridine;ethane?
2,5-dimethyl-3-propan-2-ylpyridine;ethane has a molecular weight of 179.31 g/mol, XLogP of 3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-3-propan-2-ylpyridine;ethane is sourced from PubChem (CID 158491819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).