C84H104N21O15S3+ — CID 158493438
CID 158493438 (PubChem CID 158493438) has the molecular formula C84H104N21O15S3+ and a molecular weight of 1744.09 g/mol.
| Compound Name | CID 158493438 |
|---|---|
| PubChem CID | 158493438 |
| Molecular Formula | C84H104N21O15S3+ |
| Molecular Weight | 1744.09 g/mol |
| Exact Mass | 1742.72 |
| IUPAC Name | — |
| SMILES | CC1(CCOc2ccn(-c3ccc4c(n3)N3CC(CC3(C)C)OCCNC3=[C+]C=CC(=N3)S(=O)(=O)NC4=O)n2)CC1.CC1(CCOc2ccn(-c3ccc4c(n3)N3CC(CC3(C)C)OCCNc3cccc(n3)S(=O)(=O)NC4=O)n2)CC1.CC1(CCOc2ccn(-c3ccc4c(n3)N3CC(CC3(C)C)OCCNc3cccc(n3)S(=O)(=O)NC4=O)n2)CC1 |
| InChI | InChI=1S/2C28H35N7O5S.C28H33N7O5S/c3*1-27(2)17-19-18-34(27)25-20(26(36)33-41(37,38)24-6-4-5-21(30-24)29-13-16-39-19)7-8-22(31-25)35-14-9-23(32-35)40-15-12-28(3)10-11-28/h2*4-9,14,19H,10-13,15-18H2,1-3H3,(H,29,30)(H,33,36);4,6-9,14,19H,10-13,15-18H2,1-3H3,(H-,29,30,33,36)/p+1 |
| InChIKey | HIZFAQYNSADSLJ-UHFFFAOYSA-O |
| XLogP | 8.78 |
| TPSA | 421.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 33 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 123 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1744.09 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 33 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|