About 1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene
1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene (PubChem CID 158493904) has the molecular formula C15H19F3
and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene |
| PubChem CID | 158493904 |
| Molecular Formula | C15H19F3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene |
| SMILES | CC1=CCCCC1.Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C8H7F3.C7H12/c1-6-2-4-7(5-3-6)8(9,10)11;1-7-5-3-2-4-6-7/h2-5H,1H3;5H,2-4,6H2,1H3 |
| InChIKey | HJARYIYNGOSVOT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene?
The IUPAC name of 1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene (CID 158493904) is 1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene.
What is the SMILES notation for 1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene?
The canonical SMILES for 1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene is CC1=CCCCC1.Cc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene?
The InChIKey is HJARYIYNGOSVOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3.C7H12/c1-6-2-4-7(5-3-6)8(9,10)11;1-7-5-3-2-4-6-7/h2-5H,1H3;5H,2-4,6H2,1H3.
What are the key properties of 1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene?
1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene has a molecular weight of 256.31 g/mol, XLogP of 5.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcyclohexene;1-methyl-4-(trifluoromethyl)benzene is sourced from PubChem (CID 158493904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).