C16H28N4O7 — CID 158494475
4-O-amino 1-O-tert-butyl butanedioate;tert-butyl N-(1,3,4-oxadiazol-2-ylmethyl)carbamate (PubChem CID 158494475) has the molecular formula C16H28N4O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is 4-O-amino 1-O-tert-butyl butanedioate;tert-butyl N-(1,3,4-oxadiazol-2-ylmethyl)carbamate.
| Compound Name | 4-O-amino 1-O-tert-butyl butanedioate;tert-butyl N-(1,3,4-oxadiazol-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 158494475 |
| Molecular Formula | C16H28N4O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 4-O-amino 1-O-tert-butyl butanedioate;tert-butyl N-(1,3,4-oxadiazol-2-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)CCC(=O)ON.CC(C)(C)OC(=O)NCc1nnco1 |
| InChI | InChI=1S/C8H13N3O3.C8H15NO4/c1-8(2,3)14-7(12)9-4-6-11-10-5-13-6;1-8(2,3)12-6(10)4-5-7(11)13-9/h5H,4H2,1-3H3,(H,9,12);4-5,9H2,1-3H3 |
| InChIKey | HJCKKVHDSKUBDB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 155.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|