C16H27N5O2 — CID 158495467
(14S)-4-(methylamino)-3-oxo-9-prop-2-enyl-1,4,9-triazacyclotetradec-6-yne-14-carboxamide (PubChem CID 158495467) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is (14S)-4-(methylamino)-3-oxo-9-prop-2-enyl-1,4,9-triazacyclotetradec-6-yne-14-carboxamide.
| Compound Name | (14S)-4-(methylamino)-3-oxo-9-prop-2-enyl-1,4,9-triazacyclotetradec-6-yne-14-carboxamide |
|---|---|
| PubChem CID | 158495467 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | (14S)-4-(methylamino)-3-oxo-9-prop-2-enyl-1,4,9-triazacyclotetradec-6-yne-14-carboxamide |
| SMILES | C=CCN1CC#CCN(NC)C(=O)CN[C@H](C(N)=O)CCCC1 |
| InChI | InChI=1S/C16H27N5O2/c1-3-9-20-10-5-4-8-14(16(17)23)19-13-15(22)21(18-2)12-7-6-11-20/h3,14,18-19H,1,4-5,8-13H2,2H3,(H2,17,23)/t14-/m0/s1 |
| InChIKey | QAJDRMYSVGXOME-AWEZNQCLSA-N |
| XLogP | -0.93 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|