About 4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one
4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one (PubChem CID 158496620) has the molecular formula C16H14N2O3
and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one |
| PubChem CID | 158496620 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one |
| SMILES | COc1cc(-c2cc(C3=CC=CC3)nc(=O)[nH]2)ccc1O |
| InChI | InChI=1S/C16H14N2O3/c1-21-15-8-11(6-7-14(15)19)13-9-12(17-16(20)18-13)10-4-2-3-5-10/h2-4,6-9,19H,5H2,1H3,(H,17,18,20) |
| InChIKey | HJJGZVKQGHMBSR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one?
The IUPAC name of 4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one (CID 158496620) is 4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one.
What is the SMILES notation for 4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one?
The canonical SMILES for 4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one is COc1cc(-c2cc(C3=CC=CC3)nc(=O)[nH]2)ccc1O.
What is the InChIKey of 4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one?
The InChIKey is HJJGZVKQGHMBSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3/c1-21-15-8-11(6-7-14(15)19)13-9-12(17-16(20)18-13)10-4-2-3-5-10/h2-4,6-9,19H,5H2,1H3,(H,17,18,20).
What are the key properties of 4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one?
4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one has a molecular weight of 282.30 g/mol, XLogP of 2.49, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopenta-1,3-dien-1-yl-6-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one is sourced from PubChem (CID 158496620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).