About methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone)
methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone) (PubChem CID 158498074) has the molecular formula C30H73N3O3
and a molecular weight of 523.93 g/mol. Its IUPAC name is methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone).
Molecular Properties
| Compound Name | methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone) |
| PubChem CID | 158498074 |
| Molecular Formula | C30H73N3O3 |
| Molecular Weight | 523.93 g/mol |
| Exact Mass | 523.57 |
| IUPAC Name | methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone) |
| SMILES | C.C.C.C.C.C.C.C.CC(=O)C1CCCNC1.CC(=O)C1CCCNC1.CC(=O)C1CNCC(C)C1 |
| InChI | InChI=1S/C8H15NO.2C7H13NO.8CH4/c1-6-3-8(7(2)10)5-9-4-6;2*1-6(9)7-3-2-4-8-5-7;;;;;;;;/h6,8-9H,3-5H2,1-2H3;2*7-8H,2-5H2,1H3;8*1H4 |
| InChIKey | HJNRYBUPTTXZPF-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.93 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone)?
The IUPAC name of methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone) (CID 158498074) is methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone).
What is the SMILES notation for methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone)?
The canonical SMILES for methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone) is C.C.C.C.C.C.C.C.CC(=O)C1CCCNC1.CC(=O)C1CCCNC1.CC(=O)C1CNCC(C)C1.
What is the InChIKey of methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone)?
The InChIKey is HJNRYBUPTTXZPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.2C7H13NO.8CH4/c1-6-3-8(7(2)10)5-9-4-6;2*1-6(9)7-3-2-4-8-5-7;;;;;;;;/h6,8-9H,3-5H2,1-2H3;2*7-8H,2-5H2,1H3;8*1H4.
What are the key properties of methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone)?
methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone) has a molecular weight of 523.93 g/mol, XLogP of 7.06, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-(5-methylpiperidin-3-yl)ethanone;bis(1-piperidin-3-ylethanone) is sourced from PubChem (CID 158498074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).