C12H26N4O3 — CID 158499294
1-ethyl-3-[1-[2-(ethylcarbamoylamino)propoxy]propan-2-yl]urea (PubChem CID 158499294) has the molecular formula C12H26N4O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-ethyl-3-[1-[2-(ethylcarbamoylamino)propoxy]propan-2-yl]urea.
| Compound Name | 1-ethyl-3-[1-[2-(ethylcarbamoylamino)propoxy]propan-2-yl]urea |
|---|---|
| PubChem CID | 158499294 |
| Molecular Formula | C12H26N4O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 1-ethyl-3-[1-[2-(ethylcarbamoylamino)propoxy]propan-2-yl]urea |
| SMILES | CCNC(=O)NC(C)COCC(C)NC(=O)NCC |
| InChI | InChI=1S/C12H26N4O3/c1-5-13-11(17)15-9(3)7-19-8-10(4)16-12(18)14-6-2/h9-10H,5-8H2,1-4H3,(H2,13,15,17)(H2,14,16,18) |
| InChIKey | HJRPTNCKOFIVJI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |