C14H21NO3Si — CID 15849943
6-methyl-9-trimethylsilyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-8-ol (PubChem CID 15849943) has the molecular formula C14H21NO3Si and a molecular weight of 279.41 g/mol. Its IUPAC name is 6-methyl-9-trimethylsilyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-8-ol.
| Compound Name | 6-methyl-9-trimethylsilyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-8-ol |
|---|---|
| PubChem CID | 15849943 |
| Molecular Formula | C14H21NO3Si |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 6-methyl-9-trimethylsilyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-8-ol |
| SMILES | CN1Cc2cc3c(c([Si](C)(C)C)c2C(O)C1)OCO3 |
| InChI | InChI=1S/C14H21NO3Si/c1-15-6-9-5-11-13(18-8-17-11)14(19(2,3)4)12(9)10(16)7-15/h5,10,16H,6-8H2,1-4H3 |
| InChIKey | QTHOGRWVGBVQIQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|