C24H28N2O4 — CID 158500673
methyl (8S,11R,14S)-14-amino-3,11,18-trimethyl-10,13-dioxo-9-azatricyclo[13.3.1.12,6]icosa-1(18),2,4,6(20),15(19),16-hexaene-8-carboxylate (PubChem CID 158500673) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is methyl (8S,11R,14S)-14-amino-3,11,18-trimethyl-10,13-dioxo-9-azatricyclo[13.3.1.12,6]icosa-1(18),2,4,6(20),15(19),16-hexaene-8-carboxylate.
| Compound Name | methyl (8S,11R,14S)-14-amino-3,11,18-trimethyl-10,13-dioxo-9-azatricyclo[13.3.1.12,6]icosa-1(18),2,4,6(20),15(19),16-hexaene-8-carboxylate |
|---|---|
| PubChem CID | 158500673 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | methyl (8S,11R,14S)-14-amino-3,11,18-trimethyl-10,13-dioxo-9-azatricyclo[13.3.1.12,6]icosa-1(18),2,4,6(20),15(19),16-hexaene-8-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2ccc(C)c(c2)-c2cc(ccc2C)[C@H](N)C(=O)C[C@@H](C)C(=O)N1 |
| InChI | InChI=1S/C24H28N2O4/c1-13-5-7-16-10-18(13)19-12-17(8-6-14(19)2)22(25)21(27)9-15(3)23(28)26-20(11-16)24(29)30-4/h5-8,10,12,15,20,22H,9,11,25H2,1-4H3,(H,26,28)/t15-,20+,22+/m1/s1 |
| InChIKey | KHLHPQGEZSIMIO-PDXHDDNESA-N |
| XLogP | 2.78 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |