C28H29F3N6O8S — CID 158500981
7-[7-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-azatricyclo[3.2.0.01,6]heptan-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid;methanesulfonic acid (PubChem CID 158500981) has the molecular formula C28H29F3N6O8S and a molecular weight of 666.64 g/mol. Its IUPAC name is 7-[7-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-azatricyclo[3.2.0.01,6]heptan-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid;methanesulfonic acid.
| Compound Name | 7-[7-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-azatricyclo[3.2.0.01,6]heptan-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 158500981 |
| Molecular Formula | C28H29F3N6O8S |
| Molecular Weight | 666.64 g/mol |
| Exact Mass | 666.17 |
| IUPAC Name | 7-[7-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-azatricyclo[3.2.0.01,6]heptan-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.C[C@H](N)C(=O)N[C@@H](C)C(=O)NC1C2C3CN(c4nc5c(cc4F)c(=O)c(C(=O)O)cn5-c4ccc(F)cc4F)CC312 |
| InChI | InChI=1S/C27H25F3N6O5.CH4O3S/c1-10(31)24(38)32-11(2)25(39)33-21-19-15-8-35(9-27(15,19)21)23-17(30)6-13-20(37)14(26(40)41)7-36(22(13)34-23)18-4-3-12(28)5-16(18)29;1-5(2,3)4/h3-7,10-11,15,19,21H,8-9,31H2,1-2H3,(H,32,38)(H,33,39)(H,40,41);1H3,(H,2,3,4)/t10-,11-,15?,19?,21?,27?;/m0./s1 |
| InChIKey | RYVABWWBLCRJGS-CDSGOERESA-N |
| XLogP | 0.41 |
| TPSA | 214.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.64 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|