C11H21ClSi — CID 158501009
5-(chloromethyl)-1,2,3,4,5-pentamethylcyclopenta-1,3-diene;silane (PubChem CID 158501009) has the molecular formula C11H21ClSi and a molecular weight of 216.83 g/mol. Its IUPAC name is 5-(chloromethyl)-1,2,3,4,5-pentamethylcyclopenta-1,3-diene;silane.
| Compound Name | 5-(chloromethyl)-1,2,3,4,5-pentamethylcyclopenta-1,3-diene;silane |
|---|---|
| PubChem CID | 158501009 |
| Molecular Formula | C11H21ClSi |
| Molecular Weight | 216.83 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 5-(chloromethyl)-1,2,3,4,5-pentamethylcyclopenta-1,3-diene;silane |
| SMILES | CC1=C(C)C(C)(CCl)C(C)=C1C.[SiH4] |
| InChI | InChI=1S/C11H17Cl.H4Si/c1-7-8(2)10(4)11(5,6-12)9(7)3;/h6H2,1-5H3;1H4 |
| InChIKey | HJWVPYYRBGQITP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.83 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|