About 3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine
3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine (PubChem CID 158501630) has the molecular formula C10H14BNO
and a molecular weight of 175.04 g/mol. Its IUPAC name is 3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine.
Molecular Properties
| Compound Name | 3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine |
| PubChem CID | 158501630 |
| Molecular Formula | C10H14BNO |
| Molecular Weight | 175.04 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine |
| SMILES | CCC1OB(C)c2c(N)cccc21 |
| InChI | InChI=1S/C10H14BNO/c1-3-9-7-5-4-6-8(12)10(7)11(2)13-9/h4-6,9H,3,12H2,1-2H3 |
| InChIKey | CSVZNMGJACFRPV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.04 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine?
The IUPAC name of 3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine (CID 158501630) is 3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine.
What is the SMILES notation for 3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine?
The canonical SMILES for 3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine is CCC1OB(C)c2c(N)cccc21.
What is the InChIKey of 3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine?
The InChIKey is CSVZNMGJACFRPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BNO/c1-3-9-7-5-4-6-8(12)10(7)11(2)13-9/h4-6,9H,3,12H2,1-2H3.
What are the key properties of 3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine?
3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine has a molecular weight of 175.04 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-amine is sourced from PubChem (CID 158501630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).