C15H15I4NO4 — CID 158501732
CID 158501732 (PubChem CID 158501732) has the molecular formula C15H15I4NO4 and a molecular weight of 788.94 g/mol.
| Compound Name | CID 158501732 |
|---|---|
| PubChem CID | 158501732 |
| Molecular Formula | C15H15I4NO4 |
| Molecular Weight | 788.94 g/mol |
| Exact Mass | 788.75 |
| IUPAC Name | — |
| SMILES | NC(Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(=O)O.[3H][3H].[3H][3H] |
| InChI | InChI=1S/C15H11I4NO4.2H2/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23;;/h1-2,4-5,12,21H,3,20H2,(H,22,23);2*1H/i;2*1+2T |
| InChIKey | HJYYTIAIIJGMCA-OQJHILNHSA-N |
| XLogP | 5.05 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.94 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|