About aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde
aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde (PubChem CID 158502151) has the molecular formula C24H25NO
and a molecular weight of 343.47 g/mol. Its IUPAC name is aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde.
Molecular Properties
| Compound Name | aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde |
| PubChem CID | 158502151 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde |
| SMILES | C1=CC2CCC1C2.Nc1ccccc1.O=Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H8O.C7H10.C6H7N/c12-8-9-5-6-10-3-1-2-4-11(10)7-9;1-2-7-4-3-6(1)5-7;7-6-4-2-1-3-5-6/h1-8H;1-2,6-7H,3-5H2;1-5H,7H2 |
| InChIKey | HKAFSAYRKCTPAT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde?
The IUPAC name of aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde (CID 158502151) is aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde.
What is the SMILES notation for aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde?
The canonical SMILES for aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde is C1=CC2CCC1C2.Nc1ccccc1.O=Cc1ccc2ccccc2c1.
What is the InChIKey of aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde?
The InChIKey is HKAFSAYRKCTPAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O.C7H10.C6H7N/c12-8-9-5-6-10-3-1-2-4-11(10)7-9;1-2-7-4-3-6(1)5-7;7-6-4-2-1-3-5-6/h1-8H;1-2,6-7H,3-5H2;1-5H,7H2.
What are the key properties of aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde?
aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde has a molecular weight of 343.47 g/mol, XLogP of 5.89, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;bicyclo[2.2.1]hept-2-ene;naphthalene-2-carbaldehyde is sourced from PubChem (CID 158502151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).