About 4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine
4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine (PubChem CID 158502197) has the molecular formula C14H17N3O2
and a molecular weight of 260.32 g/mol. Its IUPAC name is 4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine.
Molecular Properties
| Compound Name | 4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine |
| PubChem CID | 158502197 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)n1.[2H]c1cc(C)nc(C)c1 |
| InChI | InChI=1S/C7H8N2O2.C7H9N/c1-5-3-7(9(10)11)4-6(2)8-5;1-6-4-3-5-7(2)8-6/h3-4H,1-2H3;3-5H,1-2H3/i;3D |
| InChIKey | HKAJJSYEEBTKMS-UGQHUCJLSA-N |
| XLogP | 3.31 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine?
The IUPAC name of 4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine (CID 158502197) is 4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine.
What is the SMILES notation for 4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine?
The canonical SMILES for 4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine is Cc1cc([N+](=O)[O-])cc(C)n1.[2H]c1cc(C)nc(C)c1.
What is the InChIKey of 4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine?
The InChIKey is HKAJJSYEEBTKMS-UGQHUCJLSA-N. The full InChI is InChI=1S/C7H8N2O2.C7H9N/c1-5-3-7(9(10)11)4-6(2)8-5;1-6-4-3-5-7(2)8-6/h3-4H,1-2H3;3-5H,1-2H3/i;3D.
What are the key properties of 4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine?
4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine has a molecular weight of 260.32 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-deuterio-2,6-dimethylpyridine;2,6-dimethyl-4-nitropyridine is sourced from PubChem (CID 158502197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).