C32H34F4N6 — CID 158502998
5-[difluoro(phenyl)methyl]-2-piperidin-1-ylpyrimidine (PubChem CID 158502998) has the molecular formula C32H34F4N6 and a molecular weight of 578.66 g/mol. Its IUPAC name is 5-[difluoro(phenyl)methyl]-2-piperidin-1-ylpyrimidine.
| Compound Name | 5-[difluoro(phenyl)methyl]-2-piperidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 158502998 |
| Molecular Formula | C32H34F4N6 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | 5-[difluoro(phenyl)methyl]-2-piperidin-1-ylpyrimidine |
| SMILES | FC(F)(c1ccccc1)c1cnc(N2CCCCC2)nc1.FC(F)(c1ccccc1)c1cnc(N2CCCCC2)nc1 |
| InChI | InChI=1S/2C16H17F2N3/c2*17-16(18,13-7-3-1-4-8-13)14-11-19-15(20-12-14)21-9-5-2-6-10-21/h2*1,3-4,7-8,11-12H,2,5-6,9-10H2 |
| InChIKey | HKCWWYPUWIJHKK-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |