C32H43BN4O8 — CID 158504717
N-[(2R,3S,6R)-6-[(4R)-4-[2-(dimethylamino)-2-oxoethyl]-4-(dimethylcarbamoyl)-6-oxo-1,3,2-dioxaborinan-2-yl]-2-hydroxy-8-methyl-4-oxononan-3-yl]-6-phenylpyridine-2-carboxamide (PubChem CID 158504717) has the molecular formula C32H43BN4O8 and a molecular weight of 622.53 g/mol. Its IUPAC name is N-[(2R,3S,6R)-6-[(4R)-4-[2-(dimethylamino)-2-oxoethyl]-4-(dimethylcarbamoyl)-6-oxo-1,3,2-dioxaborinan-2-yl]-2-hydroxy-8-methyl-4-oxononan-3-yl]-6-phenylpyridine-2-carboxamide.
| Compound Name | N-[(2R,3S,6R)-6-[(4R)-4-[2-(dimethylamino)-2-oxoethyl]-4-(dimethylcarbamoyl)-6-oxo-1,3,2-dioxaborinan-2-yl]-2-hydroxy-8-methyl-4-oxononan-3-yl]-6-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 158504717 |
| Molecular Formula | C32H43BN4O8 |
| Molecular Weight | 622.53 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | N-[(2R,3S,6R)-6-[(4R)-4-[2-(dimethylamino)-2-oxoethyl]-4-(dimethylcarbamoyl)-6-oxo-1,3,2-dioxaborinan-2-yl]-2-hydroxy-8-methyl-4-oxononan-3-yl]-6-phenylpyridine-2-carboxamide |
| SMILES | CC(C)C[C@H](CC(=O)[C@@H](NC(=O)c1cccc(-c2ccccc2)n1)[C@@H](C)O)B1OC(=O)C[C@](CC(=O)N(C)C)(C(=O)N(C)C)O1 |
| InChI | InChI=1S/C32H43BN4O8/c1-20(2)16-23(33-44-28(41)19-32(45-33,31(43)37(6)7)18-27(40)36(4)5)17-26(39)29(21(3)38)35-30(42)25-15-11-14-24(34-25)22-12-9-8-10-13-22/h8-15,20-21,23,29,38H,16-19H2,1-7H3,(H,35,42)/t21-,23-,29+,32-/m1/s1 |
| InChIKey | HKIGFOGLUVSMSQ-WMQOSVEOSA-N |
| XLogP | 2.36 |
| TPSA | 155.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|