C30H41ClN2O6S — CID 158504950
carbon dioxide;7-chloro-N-[[4-[(3,3-dimethylcyclohexyl)sulfanylmethyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;(2R)-2,3-dihydroxypropanoic acid (PubChem CID 158504950) has the molecular formula C30H41ClN2O6S and a molecular weight of 593.19 g/mol. Its IUPAC name is carbon dioxide;7-chloro-N-[[4-[(3,3-dimethylcyclohexyl)sulfanylmethyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;(2R)-2,3-dihydroxypropanoic acid.
| Compound Name | carbon dioxide;7-chloro-N-[[4-[(3,3-dimethylcyclohexyl)sulfanylmethyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;(2R)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 158504950 |
| Molecular Formula | C30H41ClN2O6S |
| Molecular Weight | 593.19 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | carbon dioxide;7-chloro-N-[[4-[(3,3-dimethylcyclohexyl)sulfanylmethyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;(2R)-2,3-dihydroxypropanoic acid |
| SMILES | CC1(C)CCCC(SCc2ccc(CNc3c(Cl)ccc4c3CCNCC4)cc2)C1.O=C(O)[C@H](O)CO.O=C=O |
| InChI | InChI=1S/C26H35ClN2S.C3H6O4.CO2/c1-26(2)13-3-4-22(16-26)30-18-20-7-5-19(6-8-20)17-29-25-23-12-15-28-14-11-21(23)9-10-24(25)27;4-1-2(5)3(6)7;2-1-3/h5-10,22,28-29H,3-4,11-18H2,1-2H3;2,4-5H,1H2,(H,6,7);/t;2-;/m.1./s1 |
| InChIKey | HKIWCFLLDJJQSE-VGIMLWFWSA-N |
| XLogP | 4.68 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.19 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |