About 3-ethylpyrrole-2,5-dione;platinum
3-ethylpyrrole-2,5-dione;platinum (PubChem CID 158506133) has the molecular formula C6H7NO2Pt
and a molecular weight of 320.21 g/mol. Its IUPAC name is 3-ethylpyrrole-2,5-dione;platinum.
Molecular Properties
| Compound Name | 3-ethylpyrrole-2,5-dione;platinum |
| PubChem CID | 158506133 |
| Molecular Formula | C6H7NO2Pt |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 3-ethylpyrrole-2,5-dione;platinum |
| SMILES | CCC1=CC(=O)NC1=O.[Pt] |
| InChI | InChI=1S/C6H7NO2.Pt/c1-2-4-3-5(8)7-6(4)9;/h3H,2H2,1H3,(H,7,8,9); |
| InChIKey | HKMHUAKKLROGAW-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylpyrrole-2,5-dione;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylpyrrole-2,5-dione;platinum?
The IUPAC name of 3-ethylpyrrole-2,5-dione;platinum (CID 158506133) is 3-ethylpyrrole-2,5-dione;platinum.
What is the SMILES notation for 3-ethylpyrrole-2,5-dione;platinum?
The canonical SMILES for 3-ethylpyrrole-2,5-dione;platinum is CCC1=CC(=O)NC1=O.[Pt].
What is the InChIKey of 3-ethylpyrrole-2,5-dione;platinum?
The InChIKey is HKMHUAKKLROGAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2.Pt/c1-2-4-3-5(8)7-6(4)9;/h3H,2H2,1H3,(H,7,8,9);.
What are the key properties of 3-ethylpyrrole-2,5-dione;platinum?
3-ethylpyrrole-2,5-dione;platinum has a molecular weight of 320.21 g/mol, XLogP of -0.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylpyrrole-2,5-dione;platinum is sourced from PubChem (CID 158506133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).