About ethyl cyclobutanecarboxylate;formic acid
ethyl cyclobutanecarboxylate;formic acid (PubChem CID 158508137) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is ethyl cyclobutanecarboxylate;formic acid.
Molecular Properties
| Compound Name | ethyl cyclobutanecarboxylate;formic acid |
| PubChem CID | 158508137 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | ethyl cyclobutanecarboxylate;formic acid |
| SMILES | CCOC(=O)C1CCC1.O=CO |
| InChI | InChI=1S/C7H12O2.CH2O2/c1-2-9-7(8)6-4-3-5-6;2-1-3/h6H,2-5H2,1H3;1H,(H,2,3) |
| InChIKey | HKSCVDOZMKUQGH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl cyclobutanecarboxylate;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl cyclobutanecarboxylate;formic acid?
The IUPAC name of ethyl cyclobutanecarboxylate;formic acid (CID 158508137) is ethyl cyclobutanecarboxylate;formic acid.
What is the SMILES notation for ethyl cyclobutanecarboxylate;formic acid?
The canonical SMILES for ethyl cyclobutanecarboxylate;formic acid is CCOC(=O)C1CCC1.O=CO.
What is the InChIKey of ethyl cyclobutanecarboxylate;formic acid?
The InChIKey is HKSCVDOZMKUQGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.CH2O2/c1-2-9-7(8)6-4-3-5-6;2-1-3/h6H,2-5H2,1H3;1H,(H,2,3).
What are the key properties of ethyl cyclobutanecarboxylate;formic acid?
ethyl cyclobutanecarboxylate;formic acid has a molecular weight of 174.20 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl cyclobutanecarboxylate;formic acid is sourced from PubChem (CID 158508137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).