C22H26BClF3NO2 — CID 158508972
4-chloro-2-(trifluoromethyl)quinoline;2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 158508972) has the molecular formula C22H26BClF3NO2 and a molecular weight of 439.71 g/mol. Its IUPAC name is 4-chloro-2-(trifluoromethyl)quinoline;2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 4-chloro-2-(trifluoromethyl)quinoline;2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 158508972 |
| Molecular Formula | C22H26BClF3NO2 |
| Molecular Weight | 439.71 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 4-chloro-2-(trifluoromethyl)quinoline;2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2=CCCCC2)OC1(C)C.FC(F)(F)c1cc(Cl)c2ccccc2n1 |
| InChI | InChI=1S/C12H21BO2.C10H5ClF3N/c1-11(2)12(3,4)15-13(14-11)10-8-6-5-7-9-10;11-7-5-9(10(12,13)14)15-8-4-2-1-3-6(7)8/h8H,5-7,9H2,1-4H3;1-5H |
| InChIKey | HKUUNQGCZMVUMQ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.71 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|