About chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane
chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane (PubChem CID 158509110) has the molecular formula C8H25ClO2Si2
and a molecular weight of 244.91 g/mol. Its IUPAC name is chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane.
Molecular Properties
| Compound Name | chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane |
| PubChem CID | 158509110 |
| Molecular Formula | C8H25ClO2Si2 |
| Molecular Weight | 244.91 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane |
| SMILES | CO.CO[Si](C)(C)C.C[Si](C)(C)Cl |
| InChI | InChI=1S/C4H12OSi.C3H9ClSi.CH4O/c1-5-6(2,3)4;1-5(2,3)4;1-2/h1-4H3;1-3H3;2H,1H3 |
| InChIKey | HKVDOLKARODZQY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.91 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane?
The IUPAC name of chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane (CID 158509110) is chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane.
What is the SMILES notation for chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane?
The canonical SMILES for chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane is CO.CO[Si](C)(C)C.C[Si](C)(C)Cl.
What is the InChIKey of chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane?
The InChIKey is HKVDOLKARODZQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12OSi.C3H9ClSi.CH4O/c1-5-6(2,3)4;1-5(2,3)4;1-2/h1-4H3;1-3H3;2H,1H3.
What are the key properties of chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane?
chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane has a molecular weight of 244.91 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(trimethyl)silane;methanol;methoxy(trimethyl)silane is sourced from PubChem (CID 158509110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).