C20H16N4S2 — CID 15851085
5-amino-3-benzyl-7-phenyl-2-sulfanylidene-4,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile (PubChem CID 15851085) has the molecular formula C20H16N4S2 and a molecular weight of 376.51 g/mol. Its IUPAC name is 5-amino-3-benzyl-7-phenyl-2-sulfanylidene-4,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile.
| Compound Name | 5-amino-3-benzyl-7-phenyl-2-sulfanylidene-4,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 15851085 |
| Molecular Formula | C20H16N4S2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 5-amino-3-benzyl-7-phenyl-2-sulfanylidene-4,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile |
| SMILES | N#CC1=C(N)Nc2c(sc(=S)n2Cc2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C20H16N4S2/c21-11-15-16(14-9-5-2-6-10-14)17-19(23-18(15)22)24(20(25)26-17)12-13-7-3-1-4-8-13/h1-10,16,23H,12,22H2 |
| InChIKey | JEZZGRDGHYVXKZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|