C12H23I — CID 158511042
1,2,3,3,4,5-hexamethylcyclohexene;hydroiodide (PubChem CID 158511042) has the molecular formula C12H23I and a molecular weight of 294.22 g/mol. Its IUPAC name is 1,2,3,3,4,5-hexamethylcyclohexene;hydroiodide.
| Compound Name | 1,2,3,3,4,5-hexamethylcyclohexene;hydroiodide |
|---|---|
| PubChem CID | 158511042 |
| Molecular Formula | C12H23I |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1,2,3,3,4,5-hexamethylcyclohexene;hydroiodide |
| SMILES | CC1=C(C)C(C)(C)C(C)C(C)C1.I |
| InChI | InChI=1S/C12H22.HI/c1-8-7-9(2)11(4)12(5,6)10(8)3;/h8,10H,7H2,1-6H3;1H |
| InChIKey | VUKBNOWBOGEXTE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|