C63H41N3O — CID 158511636
4-(3-dibenzofuran-4-ylphenyl)-6-phenyl-2-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]pyrimidine (PubChem CID 158511636) has the molecular formula C63H41N3O and a molecular weight of 856.04 g/mol. Its IUPAC name is 4-(3-dibenzofuran-4-ylphenyl)-6-phenyl-2-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]pyrimidine.
| Compound Name | 4-(3-dibenzofuran-4-ylphenyl)-6-phenyl-2-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 158511636 |
| Molecular Formula | C63H41N3O |
| Molecular Weight | 856.04 g/mol |
| Exact Mass | 855.32 |
| IUPAC Name | 4-(3-dibenzofuran-4-ylphenyl)-6-phenyl-2-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]pyrimidine |
| SMILES | c1ccc(-c2cc(-c3cccc(-c4cccc5c4oc4ccccc45)c3)nc(-c3cccc(-c4c(-c5ccccc5)c(-c5ccccc5)nc(-c5ccccc5)c4-c4ccccc4)c3)n2)cc1 |
| InChI | InChI=1S/C63H41N3O/c1-6-21-42(22-7-1)54-41-55(48-32-18-31-47(39-48)51-36-20-37-53-52-35-16-17-38-56(52)67-62(51)53)65-63(64-54)50-34-19-33-49(40-50)57-58(43-23-8-2-9-24-43)60(45-27-12-4-13-28-45)66-61(46-29-14-5-15-30-46)59(57)44-25-10-3-11-26-44/h1-41H |
| InChIKey | HLDACGJYOSQCSY-UHFFFAOYSA-N |
| XLogP | 16.77 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.04 |
| LogP ≤ 5 | 16.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |