C11H14N2 — CID 158512301
6-tert-butyl-2H-pyrrolo[3,2-b]pyridine (PubChem CID 158512301) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 6-tert-butyl-2H-pyrrolo[3,2-b]pyridine.
| Compound Name | 6-tert-butyl-2H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 158512301 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 6-tert-butyl-2H-pyrrolo[3,2-b]pyridine |
| SMILES | CC(C)(C)c1cnc2c(c1)=NCC=2 |
| InChI | InChI=1S/C11H14N2/c1-11(2,3)8-6-10-9(13-7-8)4-5-12-10/h4,6-7H,5H2,1-3H3 |
| InChIKey | VEYKHJUNRWWHDL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |