C23H19N7O9S2 — CID 158512774
2-[[3-hydroxy-1-oxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]but-2-en-2-yl]diazenyl]-5-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]benzenesulfonic acid (PubChem CID 158512774) has the molecular formula C23H19N7O9S2 and a molecular weight of 601.58 g/mol. Its IUPAC name is 2-[[3-hydroxy-1-oxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]but-2-en-2-yl]diazenyl]-5-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[3-hydroxy-1-oxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]but-2-en-2-yl]diazenyl]-5-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 158512774 |
| Molecular Formula | C23H19N7O9S2 |
| Molecular Weight | 601.58 g/mol |
| Exact Mass | 601.07 |
| IUPAC Name | 2-[[3-hydroxy-1-oxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]but-2-en-2-yl]diazenyl]-5-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]benzenesulfonic acid |
| SMILES | CC(O)=C(/N=N/c1ccc(/N=N/c2ccc(SOOO)cc2)cc1S(=O)(=O)O)C(=O)Nc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C23H19N7O9S2/c1-12(31)21(22(32)24-14-4-8-17-19(10-14)26-23(33)25-17)30-29-18-9-5-15(11-20(18)41(35,36)37)28-27-13-2-6-16(7-3-13)40-39-38-34/h2-11,31,34H,1H3,(H,24,32)(H2,25,26,33)(H,35,36,37)/b21-12?,28-27+,30-29+ |
| InChIKey | LXERBGQDRYMQSA-FXFYWTIMSA-N |
| XLogP | 5.46 |
| TPSA | 240.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|