C42H38Cl2N8O2 — CID 158513602
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-1-methyl-5-phenylpyrazole-3-carboxamide (PubChem CID 158513602) has the molecular formula C42H38Cl2N8O2 and a molecular weight of 757.73 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)ethyl]-1-methyl-5-phenylpyrazole-3-carboxamide.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-1-methyl-5-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 158513602 |
| Molecular Formula | C42H38Cl2N8O2 |
| Molecular Weight | 757.73 g/mol |
| Exact Mass | 756.25 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-1-methyl-5-phenylpyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCCc2c[nH]c3ccc(Cl)cc23)cc1-c1ccccc1.Cn1nc(C(=O)NCCc2c[nH]c3ccc(Cl)cc23)cc1-c1ccccc1 |
| InChI | InChI=1S/2C21H19ClN4O/c2*1-26-20(14-5-3-2-4-6-14)12-19(25-26)21(27)23-10-9-15-13-24-18-8-7-16(22)11-17(15)18/h2*2-8,11-13,24H,9-10H2,1H3,(H,23,27) |
| InChIKey | HLIZCGKKXDMNFT-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.73 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |